About [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate
[2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 902750) has the molecular formula C16H14FNO3
and a molecular weight of 287.29 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate |
| PubChem CID | 902750 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FNO3/c1-18-14-5-3-2-4-13(14)16(20)21-10-15(19)11-6-8-12(17)9-7-11/h2-9,18H,10H2,1H3 |
| InChIKey | XRNPOSZWZPHRSJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate?
The IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate (CID 902750) is [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate.
What is the SMILES notation for [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate?
The canonical SMILES for [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate is CNc1ccccc1C(=O)OCC(=O)c1ccc(F)cc1.
What is the InChIKey of [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate?
The InChIKey is XRNPOSZWZPHRSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO3/c1-18-14-5-3-2-4-13(14)16(20)21-10-15(19)11-6-8-12(17)9-7-11/h2-9,18H,10H2,1H3.
What are the key properties of [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate?
[2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate has a molecular weight of 287.29 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)-2-oxoethyl] 2-(methylamino)benzoate is sourced from PubChem (CID 902750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).