C13H13BF3NO4S — CID 90275187
N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 90275187) has the molecular formula C13H13BF3NO4S and a molecular weight of 347.12 g/mol. Its IUPAC name is N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 90275187 |
| Molecular Formula | C13H13BF3NO4S |
| Molecular Weight | 347.12 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[(3R)-8-acetyl-2-hydroxy-3,4-dihydro-1,2-benzoxaborinin-3-yl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CSC(F)(F)F)C2 |
| InChI | InChI=1S/C13H13BF3NO4S/c1-7(19)9-4-2-3-8-5-10(14(21)22-12(8)9)18-11(20)6-23-13(15,16)17/h2-4,10,21H,5-6H2,1H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | PYGPGODVLMILQY-JTQLQIEISA-N |
| XLogP | 1.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.12 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|