C22H28BClO5 — CID 90275195
8-[(2S)-2-chloro-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 90275195) has the molecular formula C22H28BClO5 and a molecular weight of 418.73 g/mol. Its IUPAC name is 8-[(2S)-2-chloro-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 8-[(2S)-2-chloro-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 90275195 |
| Molecular Formula | C22H28BClO5 |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 8-[(2S)-2-chloro-2-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | CC1(C)OC(=O)c2cccc(C[C@@H](Cl)B3O[C@@H]4CC5C[C@@H](C5(C)C)[C@]4(C)O3)c2O1 |
| InChI | InChI=1S/C22H28BClO5/c1-20(2)13-10-15(20)22(5)16(11-13)28-23(29-22)17(24)9-12-7-6-8-14-18(12)26-21(3,4)27-19(14)25/h6-8,13,15-17H,9-11H2,1-5H3/t13?,15-,16+,17+,22-/m0/s1 |
| InChIKey | DPSCESKSPDKLHU-MYCANXNJSA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|