C26H34BN5O6S — CID 90275206
N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 90275206) has the molecular formula C26H34BN5O6S and a molecular weight of 555.47 g/mol. Its IUPAC name is N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 90275206 |
| Molecular Formula | C26H34BN5O6S |
| Molecular Weight | 555.47 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cn1nnnc1SCC(=O)N[C@@H](Cc1cccc2c1OC(C)(C)OC2=O)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C26H34BN5O6S/c1-24(2)15-11-17(24)26(5)18(12-15)37-27(38-26)19(28-20(33)13-39-23-29-30-31-32(23)6)10-14-8-7-9-16-21(14)35-25(3,4)36-22(16)34/h7-9,15,17-19H,10-13H2,1-6H3,(H,28,33)/t15-,17-,18+,19-,26-/m0/s1 |
| InChIKey | RNYLBRWCHIEFKM-CKLPHUHOSA-N |
| XLogP | 2.58 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|