C23H30BNO6 — CID 90275211
N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]formamide (PubChem CID 90275211) has the molecular formula C23H30BNO6 and a molecular weight of 427.31 g/mol. Its IUPAC name is N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]formamide.
| Compound Name | N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]formamide |
|---|---|
| PubChem CID | 90275211 |
| Molecular Formula | C23H30BNO6 |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-[(1R)-2-(2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]formamide |
| SMILES | CC1(C)OC(=O)c2cccc(C[C@H](NC=O)B3OC4C[C@@H]5C[C@@H](C5(C)C)[C@]4(C)O3)c2O1 |
| InChI | InChI=1S/C23H30BNO6/c1-21(2)14-10-16(21)23(5)17(11-14)30-24(31-23)18(25-12-26)9-13-7-6-8-15-19(13)28-22(3,4)29-20(15)27/h6-8,12,14,16-18H,9-11H2,1-5H3,(H,25,26)/t14-,16-,17?,18-,23-/m0/s1 |
| InChIKey | GVRUYJQRGLYDIL-PMNMNLBFSA-N |
| XLogP | 2.90 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|