About 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one
4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one (PubChem CID 90275263) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one.
Molecular Properties
| Compound Name | 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one |
| PubChem CID | 90275263 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one |
| SMILES | CC(C)(C)C1NC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C12H16N2O/c1-12(2,3)10-8-6-4-5-7-9(8)13-11(15)14-10/h4-7,10H,1-3H3,(H2,13,14,15) |
| InChIKey | WHHUYFBCSFAIFV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one?
The IUPAC name of 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one (CID 90275263) is 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one.
What is the SMILES notation for 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one?
The canonical SMILES for 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one is CC(C)(C)C1NC(=O)Nc2ccccc21.
What is the InChIKey of 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one?
The InChIKey is WHHUYFBCSFAIFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-12(2,3)10-8-6-4-5-7-9(8)13-11(15)14-10/h4-7,10H,1-3H3,(H2,13,14,15).
What are the key properties of 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one?
4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one has a molecular weight of 204.27 g/mol, XLogP of 2.91, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,4-dihydro-1H-quinazolin-2-one is sourced from PubChem (CID 90275263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).