C16H17F7O5S — CID 90275648
[3-(2,5-dimethyl-1,3-dioxan-2-yl)-1,1,1-trifluoropropan-2-yl] 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate (PubChem CID 90275648) has the molecular formula C16H17F7O5S and a molecular weight of 454.36 g/mol. Its IUPAC name is [3-(2,5-dimethyl-1,3-dioxan-2-yl)-1,1,1-trifluoropropan-2-yl] 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate.
| Compound Name | [3-(2,5-dimethyl-1,3-dioxan-2-yl)-1,1,1-trifluoropropan-2-yl] 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90275648 |
| Molecular Formula | C16H17F7O5S |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | [3-(2,5-dimethyl-1,3-dioxan-2-yl)-1,1,1-trifluoropropan-2-yl] 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate |
| SMILES | Cc1c(F)c(F)c(S(=O)(=O)OC(CC2(C)OCC(C)CO2)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C16H17F7O5S/c1-7-5-26-15(3,27-6-7)4-9(16(21,22)23)28-29(24,25)14-12(19)10(17)8(2)11(18)13(14)20/h7,9H,4-6H2,1-3H3 |
| InChIKey | SITYNCZFXFSCFD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|