C22H28N6O2S2 — CID 90275893
3-N-(4-morpholin-4-ylcyclohexyl)-5-N-(1,2-thiazol-4-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-3,5-diamine (PubChem CID 90275893) has the molecular formula C22H28N6O2S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is 3-N-(4-morpholin-4-ylcyclohexyl)-5-N-(1,2-thiazol-4-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-3,5-diamine.
| Compound Name | 3-N-(4-morpholin-4-ylcyclohexyl)-5-N-(1,2-thiazol-4-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-3,5-diamine |
|---|---|
| PubChem CID | 90275893 |
| Molecular Formula | C22H28N6O2S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-N-(4-morpholin-4-ylcyclohexyl)-5-N-(1,2-thiazol-4-yl)-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-3,5-diamine |
| SMILES | c1nscc1Nc1nc(NC2CCC(N3CCOCC3)CC2)c2c3c(sc2n1)COCC3 |
| InChI | InChI=1S/C22H28N6O2S2/c1-3-16(28-6-9-29-10-7-28)4-2-14(1)24-20-19-17-5-8-30-12-18(17)32-21(19)27-22(26-20)25-15-11-23-31-13-15/h11,13-14,16H,1-10,12H2,(H2,24,25,26,27) |
| InChIKey | MCYQWORQRRANPG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |