C19H31N4O3PS — CID 90276001
(2R,3R,4S)-2-(7-amino-2-butylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol (PubChem CID 90276001) has the molecular formula C19H31N4O3PS and a molecular weight of 426.52 g/mol. Its IUPAC name is (2R,3R,4S)-2-(7-amino-2-butylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(7-amino-2-butylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 90276001 |
| Molecular Formula | C19H31N4O3PS |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (2R,3R,4S)-2-(7-amino-2-butylsulfanylimidazo[4,5-b]pyridin-3-yl)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]oxolane-3,4-diol |
| SMILES | C=P(C)(C)CCC1O[C@@H](n2c(SCCCC)nc3c(N)ccnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H31N4O3PS/c1-5-6-11-28-19-22-14-12(20)7-9-21-17(14)23(19)18-16(25)15(24)13(26-18)8-10-27(2,3)4/h7,9,13,15-16,18,24-25H,2,5-6,8,10-11H2,1,3-4H3,(H2,20,21)/t13?,15-,16-,18-/m1/s1 |
| InChIKey | UJNIBDGKBSLRSJ-ISVFTMLBSA-N |
| XLogP | 2.62 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|