C16H25N4O3P — CID 90276002
(3S,4R,5R)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-5-[7-(methylamino)imidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol (PubChem CID 90276002) has the molecular formula C16H25N4O3P and a molecular weight of 352.38 g/mol. Its IUPAC name is (3S,4R,5R)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-5-[7-(methylamino)imidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol.
| Compound Name | (3S,4R,5R)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-5-[7-(methylamino)imidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 90276002 |
| Molecular Formula | C16H25N4O3P |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (3S,4R,5R)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-5-[7-(methylamino)imidazo[4,5-b]pyridin-3-yl]oxolane-3,4-diol |
| SMILES | C=P(C)(C)CCC1O[C@@H](n2cnc3c(NC)ccnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H25N4O3P/c1-17-10-5-7-18-15-12(10)19-9-20(15)16-14(22)13(21)11(23-16)6-8-24(2,3)4/h5,7,9,11,13-14,16,21-22H,2,6,8H2,1,3-4H3,(H,17,18)/t11?,13-,14-,16-/m1/s1 |
| InChIKey | JWRTYZTZUOHWAR-IIIYTMRASA-N |
| XLogP | 1.19 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|