C28H41BO7S — CID 90276174
butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate (PubChem CID 90276174) has the molecular formula C28H41BO7S and a molecular weight of 532.51 g/mol. Its IUPAC name is butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate.
| Compound Name | butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 90276174 |
| Molecular Formula | C28H41BO7S |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | butyl 2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanyl-3-[[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
| SMILES | CCCCOC(=O)c1c(SC)ccc(CB2OC3CC4CC(C4(C)C)[C@]3(C)O2)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H41BO7S/c1-9-10-13-32-24(30)22-19(37-8)12-11-17(23(22)33-25(31)34-26(2,3)4)16-29-35-21-15-18-14-20(27(18,5)6)28(21,7)36-29/h11-12,18,20-21H,9-10,13-16H2,1-8H3/t18?,20?,21?,28-/m0/s1 |
| InChIKey | HSHLXPZOTUJSKD-UEZZYCERSA-N |
| XLogP | 6.49 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|