C29H42BClO7S — CID 90276176
butyl 3-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate (PubChem CID 90276176) has the molecular formula C29H42BClO7S and a molecular weight of 580.98 g/mol. Its IUPAC name is butyl 3-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate.
| Compound Name | butyl 3-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 90276176 |
| Molecular Formula | C29H42BClO7S |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | butyl 3-[(2S)-2-chloro-2-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-[(2-methylpropan-2-yl)oxycarbonyloxy]-6-methylsulfanylbenzoate |
| SMILES | CCCCOC(=O)c1c(SC)ccc(C[C@@H](Cl)B2OC3CC4CC(C4(C)C)[C@]3(C)O2)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H42BClO7S/c1-9-10-13-34-25(32)23-19(39-8)12-11-17(24(23)35-26(33)36-27(2,3)4)14-22(31)30-37-21-16-18-15-20(28(18,5)6)29(21,7)38-30/h11-12,18,20-22H,9-10,13-16H2,1-8H3/t18?,20?,21?,22-,29+/m1/s1 |
| InChIKey | ODVKEETUFFPOGD-VVAYEURQSA-N |
| XLogP | 7.10 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|