C11H10FNO2 — CID 90276186
(2E)-2-ethylidene-1-(3-fluoro-2-pyridinyl)butane-1,3-dione (PubChem CID 90276186) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is (2E)-2-ethylidene-1-(3-fluoro-2-pyridinyl)butane-1,3-dione.
| Compound Name | (2E)-2-ethylidene-1-(3-fluoro-2-pyridinyl)butane-1,3-dione |
|---|---|
| PubChem CID | 90276186 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2E)-2-ethylidene-1-(3-fluoro-2-pyridinyl)butane-1,3-dione |
| SMILES | C/C=C(\C(C)=O)C(=O)c1ncccc1F |
| InChI | InChI=1S/C11H10FNO2/c1-3-8(7(2)14)11(15)10-9(12)5-4-6-13-10/h3-6H,1-2H3/b8-3+ |
| InChIKey | OSUHPCHZODILEM-FPYGCLRLSA-N |
| XLogP | 1.94 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|