About (E)-11-azido-1,1,1-trifluoroundec-3-ene
(E)-11-azido-1,1,1-trifluoroundec-3-ene (PubChem CID 90276511) has the molecular formula C11H18F3N3
and a molecular weight of 249.28 g/mol. Its IUPAC name is (E)-11-azido-1,1,1-trifluoroundec-3-ene.
Molecular Properties
| Compound Name | (E)-11-azido-1,1,1-trifluoroundec-3-ene |
| PubChem CID | 90276511 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-11-azido-1,1,1-trifluoroundec-3-ene |
| SMILES | [N-]=[N+]=NCCCCCCC/C=C/CC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3/c12-11(13,14)9-7-5-3-1-2-4-6-8-10-16-17-15/h5,7H,1-4,6,8-10H2/b7-5+ |
| InChIKey | BYZZXMYVRXCYJA-FNORWQNLSA-N |
| XLogP | 5.15 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-11-azido-1,1,1-trifluoroundec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-11-azido-1,1,1-trifluoroundec-3-ene?
The IUPAC name of (E)-11-azido-1,1,1-trifluoroundec-3-ene (CID 90276511) is (E)-11-azido-1,1,1-trifluoroundec-3-ene.
What is the SMILES notation for (E)-11-azido-1,1,1-trifluoroundec-3-ene?
The canonical SMILES for (E)-11-azido-1,1,1-trifluoroundec-3-ene is [N-]=[N+]=NCCCCCCC/C=C/CC(F)(F)F.
What is the InChIKey of (E)-11-azido-1,1,1-trifluoroundec-3-ene?
The InChIKey is BYZZXMYVRXCYJA-FNORWQNLSA-N. The full InChI is InChI=1S/C11H18F3N3/c12-11(13,14)9-7-5-3-1-2-4-6-8-10-16-17-15/h5,7H,1-4,6,8-10H2/b7-5+.
What are the key properties of (E)-11-azido-1,1,1-trifluoroundec-3-ene?
(E)-11-azido-1,1,1-trifluoroundec-3-ene has a molecular weight of 249.28 g/mol, XLogP of 5.15, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-11-azido-1,1,1-trifluoroundec-3-ene is sourced from PubChem (CID 90276511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).