C14H28O2 — CID 90276646
(Z)-2,3,4,5-tetramethyl-2-(1,1,1,2-tetradeuteriopropan-2-yloxy)-5-(trideuteriomethoxy)hex-3-ene (PubChem CID 90276646) has the molecular formula C14H28O2 and a molecular weight of 235.42 g/mol. Its IUPAC name is (Z)-2,3,4,5-tetramethyl-2-(1,1,1,2-tetradeuteriopropan-2-yloxy)-5-(trideuteriomethoxy)hex-3-ene.
| Compound Name | (Z)-2,3,4,5-tetramethyl-2-(1,1,1,2-tetradeuteriopropan-2-yloxy)-5-(trideuteriomethoxy)hex-3-ene |
|---|---|
| PubChem CID | 90276646 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.25 |
| IUPAC Name | (Z)-2,3,4,5-tetramethyl-2-(1,1,1,2-tetradeuteriopropan-2-yloxy)-5-(trideuteriomethoxy)hex-3-ene |
| SMILES | [2H]C([2H])([2H])OC(C)(C)/C(C)=C(/C)C(C)(C)OC([2H])(C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C14H28O2/c1-10(2)16-14(7,8)12(4)11(3)13(5,6)15-9/h10H,1-9H3/b12-11-/i1D3,9D3,10D |
| InChIKey | NUGWXAHVXVVJAQ-LCIZPYHRSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|