C15H21N3 — CID 90277190
1,4,7-tris(prop-2-ynyl)-1,4,7-triazonane (PubChem CID 90277190) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1,4,7-tris(prop-2-ynyl)-1,4,7-triazonane.
| Compound Name | 1,4,7-tris(prop-2-ynyl)-1,4,7-triazonane |
|---|---|
| PubChem CID | 90277190 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1,4,7-tris(prop-2-ynyl)-1,4,7-triazonane |
| SMILES | C#CCN1CCN(CC#C)CCN(CC#C)CC1 |
| InChI | InChI=1S/C15H21N3/c1-4-7-16-10-12-17(8-5-2)14-15-18(9-6-3)13-11-16/h1-3H,7-15H2 |
| InChIKey | YJUDZPJARVBLCX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|