C26H21FIN7O — CID 90277242
5-fluoro-2-[1-[[5-iodo-2-(pyridin-2-ylamino)pyrimidin-4-yl]amino]propyl]-3-phenylquinazolin-4-one (PubChem CID 90277242) has the molecular formula C26H21FIN7O and a molecular weight of 593.40 g/mol. Its IUPAC name is 5-fluoro-2-[1-[[5-iodo-2-(pyridin-2-ylamino)pyrimidin-4-yl]amino]propyl]-3-phenylquinazolin-4-one.
| Compound Name | 5-fluoro-2-[1-[[5-iodo-2-(pyridin-2-ylamino)pyrimidin-4-yl]amino]propyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 90277242 |
| Molecular Formula | C26H21FIN7O |
| Molecular Weight | 593.40 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | 5-fluoro-2-[1-[[5-iodo-2-(pyridin-2-ylamino)pyrimidin-4-yl]amino]propyl]-3-phenylquinazolin-4-one |
| SMILES | CCC(Nc1nc(Nc2ccccn2)ncc1I)c1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C26H21FIN7O/c1-2-19(31-23-18(28)15-30-26(34-23)33-21-13-6-7-14-29-21)24-32-20-12-8-11-17(27)22(20)25(36)35(24)16-9-4-3-5-10-16/h3-15,19H,2H2,1H3,(H2,29,30,31,33,34) |
| InChIKey | ZJHJZKSNUKDCNF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|