About 7-[(E)-prop-1-enyl]-1,3-benzoxazole
7-[(E)-prop-1-enyl]-1,3-benzoxazole (PubChem CID 90277918) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 7-[(E)-prop-1-enyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 7-[(E)-prop-1-enyl]-1,3-benzoxazole |
| PubChem CID | 90277918 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 7-[(E)-prop-1-enyl]-1,3-benzoxazole |
| SMILES | C/C=C/c1cccc2ncoc12 |
| InChI | InChI=1S/C10H9NO/c1-2-4-8-5-3-6-9-10(8)12-7-11-9/h2-7H,1H3/b4-2+ |
| InChIKey | LWZLYBMZEMPSML-DUXPYHPUSA-N |
| XLogP | 2.86 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[(E)-prop-1-enyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(E)-prop-1-enyl]-1,3-benzoxazole?
The IUPAC name of 7-[(E)-prop-1-enyl]-1,3-benzoxazole (CID 90277918) is 7-[(E)-prop-1-enyl]-1,3-benzoxazole.
What is the SMILES notation for 7-[(E)-prop-1-enyl]-1,3-benzoxazole?
The canonical SMILES for 7-[(E)-prop-1-enyl]-1,3-benzoxazole is C/C=C/c1cccc2ncoc12.
What is the InChIKey of 7-[(E)-prop-1-enyl]-1,3-benzoxazole?
The InChIKey is LWZLYBMZEMPSML-DUXPYHPUSA-N. The full InChI is InChI=1S/C10H9NO/c1-2-4-8-5-3-6-9-10(8)12-7-11-9/h2-7H,1H3/b4-2+.
What are the key properties of 7-[(E)-prop-1-enyl]-1,3-benzoxazole?
7-[(E)-prop-1-enyl]-1,3-benzoxazole has a molecular weight of 159.19 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(E)-prop-1-enyl]-1,3-benzoxazole is sourced from PubChem (CID 90277918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).