C58H45N7O4 — CID 90278078
4-[4-[2-(2-methylpropyl)-5,6-dinitro-7-[4-[4-(N-phenylanilino)phenyl]phenyl]benzotriazol-4-yl]phenyl]-N,N-diphenylaniline (PubChem CID 90278078) has the molecular formula C58H45N7O4 and a molecular weight of 904.04 g/mol. Its IUPAC name is 4-[4-[2-(2-methylpropyl)-5,6-dinitro-7-[4-[4-(N-phenylanilino)phenyl]phenyl]benzotriazol-4-yl]phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[4-[2-(2-methylpropyl)-5,6-dinitro-7-[4-[4-(N-phenylanilino)phenyl]phenyl]benzotriazol-4-yl]phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 90278078 |
| Molecular Formula | C58H45N7O4 |
| Molecular Weight | 904.04 g/mol |
| Exact Mass | 903.35 |
| IUPAC Name | 4-[4-[2-(2-methylpropyl)-5,6-dinitro-7-[4-[4-(N-phenylanilino)phenyl]phenyl]benzotriazol-4-yl]phenyl]-N,N-diphenylaniline |
| SMILES | CC(C)Cn1nc2c(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)c([N+](=O)[O-])c([N+](=O)[O-])c(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)c2n1 |
| InChI | InChI=1S/C58H45N7O4/c1-40(2)39-61-59-55-53(45-27-23-41(24-28-45)43-31-35-51(36-32-43)62(47-15-7-3-8-16-47)48-17-9-4-10-18-48)57(64(66)67)58(65(68)69)54(56(55)60-61)46-29-25-42(26-30-46)44-33-37-52(38-34-44)63(49-19-11-5-12-20-49)50-21-13-6-14-22-50/h3-38,40H,39H2,1-2H3 |
| InChIKey | ABSGEKXJYBSZOL-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 123.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.04 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|