C54H36N6S — CID 90278080
8,11-bis[4-(N-phenylanilino)phenyl]-9-thionitrosoacenaphthyleno[1,2-b]quinoxalin-10-amine (PubChem CID 90278080) has the molecular formula C54H36N6S and a molecular weight of 800.99 g/mol. Its IUPAC name is 8,11-bis[4-(N-phenylanilino)phenyl]-9-thionitrosoacenaphthyleno[1,2-b]quinoxalin-10-amine.
| Compound Name | 8,11-bis[4-(N-phenylanilino)phenyl]-9-thionitrosoacenaphthyleno[1,2-b]quinoxalin-10-amine |
|---|---|
| PubChem CID | 90278080 |
| Molecular Formula | C54H36N6S |
| Molecular Weight | 800.99 g/mol |
| Exact Mass | 800.27 |
| IUPAC Name | 8,11-bis[4-(N-phenylanilino)phenyl]-9-thionitrosoacenaphthyleno[1,2-b]quinoxalin-10-amine |
| SMILES | Nc1c(N=S)c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c2nc3c(nc2c1-c1ccc(N(c2ccccc2)c2ccccc2)cc1)-c1cccc2cccc-3c12 |
| InChI | InChI=1S/C54H36N6S/c55-49-47(36-27-31-42(32-28-36)59(38-17-5-1-6-18-38)39-19-7-2-8-20-39)53-54(57-51-45-26-14-16-35-15-13-25-44(46(35)45)50(51)56-53)48(52(49)58-61)37-29-33-43(34-30-37)60(40-21-9-3-10-22-40)41-23-11-4-12-24-41/h1-34H,55H2 |
| InChIKey | PZKKGXLYLLSBSW-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.99 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|