C30H32N6S — CID 90278125
4,7-bis(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-2,1,3-benzothiadiazole-5,6-diamine (PubChem CID 90278125) has the molecular formula C30H32N6S and a molecular weight of 508.70 g/mol. Its IUPAC name is 4,7-bis(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-2,1,3-benzothiadiazole-5,6-diamine.
| Compound Name | 4,7-bis(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-2,1,3-benzothiadiazole-5,6-diamine |
|---|---|
| PubChem CID | 90278125 |
| Molecular Formula | C30H32N6S |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 4,7-bis(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-2,1,3-benzothiadiazole-5,6-diamine |
| SMILES | Nc1c(N)c(-c2cc3c4c(c2)CCCN4CCC3)c2nsnc2c1-c1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C30H32N6S/c31-25-23(21-13-17-5-1-9-35-10-2-6-18(14-21)29(17)35)27-28(34-37-33-27)24(26(25)32)22-15-19-7-3-11-36-12-4-8-20(16-22)30(19)36/h13-16H,1-12,31-32H2 |
| InChIKey | KMUUMFGHRIKDOI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|