C12H12O4S2 — CID 90278404
5-(2,3,7,7a-tetrahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 90278404) has the molecular formula C12H12O4S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-(2,3,7,7a-tetrahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-(2,3,7,7a-tetrahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 90278404 |
| Molecular Formula | C12H12O4S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 5-(2,3,7,7a-tetrahydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | c1sc(C2=C3OCCOC3CS2)c2c1OCCO2 |
| InChI | InChI=1S/C12H12O4S2/c1-3-15-9-7(13-1)5-17-11(9)12-10-8(6-18-12)14-2-4-16-10/h5,8H,1-4,6H2 |
| InChIKey | ASKGJWYFADIDQB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |