C29H44N6O11 — CID 90278425
5-[2-[2-[2-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-(4-carboxybutanoylamino)-5-oxopentanoic acid (PubChem CID 90278425) has the molecular formula C29H44N6O11 and a molecular weight of 652.70 g/mol. Its IUPAC name is 5-[2-[2-[2-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-(4-carboxybutanoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[2-[2-[2-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-(4-carboxybutanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90278425 |
| Molecular Formula | C29H44N6O11 |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | 5-[2-[2-[2-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-(4-carboxybutanoylamino)-5-oxopentanoic acid |
| SMILES | NC(=O)C(CCCCNC(=O)c1ccc(N)cc1)NC(=O)COCCOCCNC(=O)CCC(NC(=O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H44N6O11/c30-20-9-7-19(8-10-20)28(42)33-13-2-1-4-21(27(31)41)34-25(38)18-46-17-16-45-15-14-32-23(36)12-11-22(29(43)44)35-24(37)5-3-6-26(39)40/h7-10,21-22H,1-6,11-18,30H2,(H2,31,41)(H,32,36)(H,33,42)(H,34,38)(H,35,37)(H,39,40)(H,43,44) |
| InChIKey | UGPRIUCZKLJUBC-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 278.57 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|