C30H36N2O2 — CID 90278490
(2Z,4E)-2-cyano-5-(11-decyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)penta-2,4-dienoic acid (PubChem CID 90278490) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is (2Z,4E)-2-cyano-5-(11-decyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)penta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-2-cyano-5-(11-decyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 90278490 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (2Z,4E)-2-cyano-5-(11-decyl-5,6-dihydrobenzo[b][1]benzazepin-3-yl)penta-2,4-dienoic acid |
| SMILES | CCCCCCCCCCN1c2ccccc2CCc2cc(/C=C/C=C(/C#N)C(=O)O)ccc21 |
| InChI | InChI=1S/C30H36N2O2/c1-2-3-4-5-6-7-8-11-21-32-28-16-10-9-14-25(28)18-19-26-22-24(17-20-29(26)32)13-12-15-27(23-31)30(33)34/h9-10,12-17,20,22H,2-8,11,18-19,21H2,1H3,(H,33,34)/b13-12+,27-15- |
| InChIKey | RSWTXQVWDHCZEZ-ZCGFKIFISA-N |
| XLogP | 7.61 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|