C11H17NO2 — CID 90278644
4-[[(2Z,4Z)-3-methylhexa-2,4-dienylidene]amino]butanoic acid (PubChem CID 90278644) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-[[(2Z,4Z)-3-methylhexa-2,4-dienylidene]amino]butanoic acid.
| Compound Name | 4-[[(2Z,4Z)-3-methylhexa-2,4-dienylidene]amino]butanoic acid |
|---|---|
| PubChem CID | 90278644 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 4-[[(2Z,4Z)-3-methylhexa-2,4-dienylidene]amino]butanoic acid |
| SMILES | C/C=C\C(C)=C/C=N/CCCC(=O)O |
| InChI | InChI=1S/C11H17NO2/c1-3-5-10(2)7-9-12-8-4-6-11(13)14/h3,5,7,9H,4,6,8H2,1-2H3,(H,13,14)/b5-3-,10-7-,12-9+ |
| InChIKey | KHLDGXGDXVZYLH-CZWVGNKWSA-N |
| XLogP | 2.44 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|