C31H33F6N5O4 — CID 90279092
[(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-bis(4-fluorophenyl)propanoyl]-methylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 90279092) has the molecular formula C31H33F6N5O4 and a molecular weight of 653.62 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-bis(4-fluorophenyl)propanoyl]-methylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-bis(4-fluorophenyl)propanoyl]-methylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 90279092 |
| Molecular Formula | C31H33F6N5O4 |
| Molecular Weight | 653.62 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | [(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-bis(4-fluorophenyl)propanoyl]-methylamino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | CN(C(=O)[C@@H](N)C(c1ccc(F)cc1)c1ccc(F)cc1)c1cncc(F)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1 |
| InChI | InChI=1S/C31H33F6N5O4/c1-42(29(43)28(38)27(18-2-6-20(32)7-3-18)19-4-8-21(33)9-5-19)26-14-39-13-25(34)24(26)11-10-23-12-40-22(15-45-23)16-46-30(44)41-17-31(35,36)37/h2-9,13-14,22-23,27-28,40H,10-12,15-17,38H2,1H3,(H,41,44)/t22-,23+,28-/m0/s1 |
| InChIKey | QABTWFGTNYQKHT-JWZKTCGFSA-N |
| XLogP | 4.20 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |