C23H25F2N7OS — CID 90279545
5-amino-N-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 90279545) has the molecular formula C23H25F2N7OS and a molecular weight of 485.56 g/mol. Its IUPAC name is 5-amino-N-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-amino-N-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90279545 |
| Molecular Formula | C23H25F2N7OS |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 5-amino-N-[4-[(3S)-3-aminopiperidin-1-yl]-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl]-2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1sc(-c2c(F)cccc2F)nc1C(=O)Nc1cnc2c(c1N1CCC[C@H](N)C1)CCCN2 |
| InChI | InChI=1S/C23H25F2N7OS/c24-14-6-1-7-15(25)17(14)23-31-18(20(27)34-23)22(33)30-16-10-29-21-13(5-2-8-28-21)19(16)32-9-3-4-12(26)11-32/h1,6-7,10,12H,2-5,8-9,11,26-27H2,(H,28,29)(H,30,33)/t12-/m0/s1 |
| InChIKey | HCJGVVIWCFDORS-LBPRGKRZSA-N |
| XLogP | 3.60 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |