C15H30N4O4Si — CID 90279636
[(2R,3S,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-1-hydroxypentan-2-yl]carbamic acid (PubChem CID 90279636) has the molecular formula C15H30N4O4Si and a molecular weight of 358.52 g/mol. Its IUPAC name is [(2R,3S,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-1-hydroxypentan-2-yl]carbamic acid.
| Compound Name | [(2R,3S,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-1-hydroxypentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90279636 |
| Molecular Formula | C15H30N4O4Si |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | [(2R,3S,4S)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-cyclopropyl-1-hydroxypentan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]([C@H](CN=[N+]=[N-])C1CC1)[C@@H](CO)NC(=O)O |
| InChI | InChI=1S/C15H30N4O4Si/c1-15(2,3)24(4,5)23-13(12(9-20)18-14(21)22)11(8-17-19-16)10-6-7-10/h10-13,18,20H,6-9H2,1-5H3,(H,21,22)/t11-,12-,13+/m1/s1 |
| InChIKey | GVMPZODYNRBKDH-UPJWGTAASA-N |
| XLogP | 3.34 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|