C18H35N4O4Si+ — CID 90279740
[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-3-carboxy-2,2-dimethyl-1,3-oxazolidin-4-yl]-2-cyclopropylpropyl]imino-iminoazanium (PubChem CID 90279740) has the molecular formula C18H35N4O4Si+ and a molecular weight of 399.59 g/mol. Its IUPAC name is [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-3-carboxy-2,2-dimethyl-1,3-oxazolidin-4-yl]-2-cyclopropylpropyl]imino-iminoazanium.
| Compound Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-3-carboxy-2,2-dimethyl-1,3-oxazolidin-4-yl]-2-cyclopropylpropyl]imino-iminoazanium |
|---|---|
| PubChem CID | 90279740 |
| Molecular Formula | C18H35N4O4Si+ |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-3-carboxy-2,2-dimethyl-1,3-oxazolidin-4-yl]-2-cyclopropylpropyl]imino-iminoazanium |
| SMILES | CC1(C)OC[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](CN=[N+]=N)C2CC2)N1C(=O)O |
| InChI | InChI=1S/C18H34N4O4Si/c1-17(2,3)27(6,7)26-15(13(10-20-21-19)12-8-9-12)14-11-25-18(4,5)22(14)16(23)24/h12-15,19H,8-11H2,1-7H3/p+1/t13-,14-,15-/m1/s1 |
| InChIKey | VQYOIYMOGCQBDC-RBSFLKMASA-O |
| XLogP | 4.07 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|