About [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid
[(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid (PubChem CID 90279823) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid |
| PubChem CID | 90279823 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CNC[C@H](C2CC2)[C@@H]1O |
| InChI | InChI=1S/C9H16N2O3/c12-8-6(5-1-2-5)3-10-4-7(8)11-9(13)14/h5-8,10-12H,1-4H2,(H,13,14)/t6-,7-,8+/m1/s1 |
| InChIKey | LNMWDTOOZDGQFI-PRJMDXOYSA-N |
| XLogP | -0.39 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid?
The IUPAC name of [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid (CID 90279823) is [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid.
What is the SMILES notation for [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid?
The canonical SMILES for [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid is O=C(O)N[C@@H]1CNC[C@H](C2CC2)[C@@H]1O.
What is the InChIKey of [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid?
The InChIKey is LNMWDTOOZDGQFI-PRJMDXOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c12-8-6(5-1-2-5)3-10-4-7(8)11-9(13)14/h5-8,10-12H,1-4H2,(H,13,14)/t6-,7-,8+/m1/s1.
What are the key properties of [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid?
[(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid has a molecular weight of 200.24 g/mol, XLogP of -0.39, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S,5S)-5-cyclopropyl-4-hydroxypiperidin-3-yl]carbamic acid is sourced from PubChem (CID 90279823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).