C38H42F2O7 — CID 90279883
6-(2-ethylperoxy-1,1-difluoroethyl)-2,3,3-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane (PubChem CID 90279883) has the molecular formula C38H42F2O7 and a molecular weight of 648.74 g/mol. Its IUPAC name is 6-(2-ethylperoxy-1,1-difluoroethyl)-2,3,3-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane.
| Compound Name | 6-(2-ethylperoxy-1,1-difluoroethyl)-2,3,3-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 90279883 |
| Molecular Formula | C38H42F2O7 |
| Molecular Weight | 648.74 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | 6-(2-ethylperoxy-1,1-difluoroethyl)-2,3,3-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
| SMILES | CCOOCC(F)(F)C1CCC(OCc2ccccc2)(OCc2ccccc2)C(COCc2ccccc2)(OCc2ccccc2)O1 |
| InChI | InChI=1S/C38H42F2O7/c1-2-45-46-29-36(39,40)35-23-24-37(42-26-32-17-9-4-10-18-32,43-27-33-19-11-5-12-20-33)38(47-35,44-28-34-21-13-6-14-22-34)30-41-25-31-15-7-3-8-16-31/h3-22,35H,2,23-30H2,1H3 |
| InChIKey | KROUMGQWAFLSEV-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.74 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|