C32H31F6N7O3 — CID 90280148
5-[4-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-2-(2-methoxyethylamino)pyrimidin-5-yl]-2-fluorobenzamide (PubChem CID 90280148) has the molecular formula C32H31F6N7O3 and a molecular weight of 675.63 g/mol. Its IUPAC name is 5-[4-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-2-(2-methoxyethylamino)pyrimidin-5-yl]-2-fluorobenzamide.
| Compound Name | 5-[4-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-2-(2-methoxyethylamino)pyrimidin-5-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 90280148 |
| Molecular Formula | C32H31F6N7O3 |
| Molecular Weight | 675.63 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 5-[4-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-2-(2-methoxyethylamino)pyrimidin-5-yl]-2-fluorobenzamide |
| SMILES | COCCNc1ncc(-c2ccc(F)c(C(N)=O)c2)c(CC(NC(=O)Cn2nc(C(F)(F)F)c3c2CCCC3)c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C32H31F6N7O3/c1-48-9-8-40-31-41-15-23(17-6-7-24(35)22(12-17)30(39)47)26(43-31)14-25(18-10-19(33)13-20(34)11-18)42-28(46)16-45-27-5-3-2-4-21(27)29(44-45)32(36,37)38/h6-7,10-13,15,25H,2-5,8-9,14,16H2,1H3,(H2,39,47)(H,42,46)(H,40,41,43) |
| InChIKey | JUXUOLAZSFTYIL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|