C26H36N2O3 — CID 90280478
[(1S,2S,3R,4aS,8aR)-2,5,5,8a-tetramethyl-3-(1H-pyrrol-2-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone (PubChem CID 90280478) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is [(1S,2S,3R,4aS,8aR)-2,5,5,8a-tetramethyl-3-(1H-pyrrol-2-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone.
| Compound Name | [(1S,2S,3R,4aS,8aR)-2,5,5,8a-tetramethyl-3-(1H-pyrrol-2-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 90280478 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | [(1S,2S,3R,4aS,8aR)-2,5,5,8a-tetramethyl-3-(1H-pyrrol-2-ylmethylamino)-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-(3,5-dihydroxyphenyl)methanone |
| SMILES | C[C@@H]1[C@H](NCc2ccc[nH]2)C[C@H]2C(C)(C)CCC[C@@]2(C)[C@H]1C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C26H36N2O3/c1-16-21(28-15-18-7-5-10-27-18)14-22-25(2,3)8-6-9-26(22,4)23(16)24(31)17-11-19(29)13-20(30)12-17/h5,7,10-13,16,21-23,27-30H,6,8-9,14-15H2,1-4H3/t16-,21-,22+,23-,26-/m1/s1 |
| InChIKey | XPKAYQJEGNSNHO-YBGGDNJSSA-N |
| XLogP | 5.26 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |