C23H36O3 — CID 90280602
(1R,2R,4aS,8aS)-1-(hydroxymethyl)-1-(3-methoxy-5-methylphenyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-ol (PubChem CID 90280602) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (1R,2R,4aS,8aS)-1-(hydroxymethyl)-1-(3-methoxy-5-methylphenyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-ol.
| Compound Name | (1R,2R,4aS,8aS)-1-(hydroxymethyl)-1-(3-methoxy-5-methylphenyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 90280602 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (1R,2R,4aS,8aS)-1-(hydroxymethyl)-1-(3-methoxy-5-methylphenyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-2-ol |
| SMILES | COc1cc(C)cc([C@@]2(CO)[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]2(C)O)c1 |
| InChI | InChI=1S/C23H36O3/c1-16-12-17(14-18(13-16)26-6)23(15-24)21(4)10-7-9-20(2,3)19(21)8-11-22(23,5)25/h12-14,19,24-25H,7-11,15H2,1-6H3/t19-,21-,22+,23-/m0/s1 |
| InChIKey | XUYYOQSJASPECO-SNJCGAMXSA-N |
| XLogP | 4.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |