C16H30O3Si — CID 90280758
3-(1,3-dioxolan-2-yl)-2,4,4-trimethyl-7-trimethylsilylhept-6-yn-3-ol (PubChem CID 90280758) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)-2,4,4-trimethyl-7-trimethylsilylhept-6-yn-3-ol.
| Compound Name | 3-(1,3-dioxolan-2-yl)-2,4,4-trimethyl-7-trimethylsilylhept-6-yn-3-ol |
|---|---|
| PubChem CID | 90280758 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)-2,4,4-trimethyl-7-trimethylsilylhept-6-yn-3-ol |
| SMILES | CC(C)C(O)(C1OCCO1)C(C)(C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-13(2)16(17,14-18-10-11-19-14)15(3,4)9-8-12-20(5,6)7/h13-14,17H,9-11H2,1-7H3 |
| InChIKey | LPDVMRXGISRMOI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|