C13H23N — CID 90280949
pyridine;2,3,4-trimethylpentane (PubChem CID 90280949) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is pyridine;2,3,4-trimethylpentane.
| Compound Name | pyridine;2,3,4-trimethylpentane |
|---|---|
| PubChem CID | 90280949 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | pyridine;2,3,4-trimethylpentane |
| SMILES | CC(C)C(C)C(C)C.c1ccncc1 |
| InChI | InChI=1S/C8H18.C5H5N/c1-6(2)8(5)7(3)4;1-2-4-6-5-3-1/h6-8H,1-5H3;1-5H |
| InChIKey | PINZRXSUGIFXIU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |