About [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate
[3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate (PubChem CID 90281040) has the molecular formula C23H20F6N2O3
and a molecular weight of 486.41 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate |
| PubChem CID | 90281040 |
| Molecular Formula | C23H20F6N2O3 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate |
| SMILES | CC(=O)N[C@H](C)Cc1cn(C(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C23H20F6N2O3/c1-13(30-14(2)32)7-16-11-31(20-6-4-3-5-19(16)20)21(33)34-12-15-8-17(22(24,25)26)10-18(9-15)23(27,28)29/h3-6,8-11,13H,7,12H2,1-2H3,(H,30,32)/t13-/m1/s1 |
| InChIKey | SPNUVZOPSXISML-CYBMUJFWSA-N |
| XLogP | 5.93 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate (CID 90281040) is [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate is CC(=O)N[C@H](C)Cc1cn(C(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc12.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate?
The InChIKey is SPNUVZOPSXISML-CYBMUJFWSA-N. The full InChI is InChI=1S/C23H20F6N2O3/c1-13(30-14(2)32)7-16-11-31(20-6-4-3-5-19(16)20)21(33)34-12-15-8-17(22(24,25)26)10-18(9-15)23(27,28)29/h3-6,8-11,13H,7,12H2,1-2H3,(H,30,32)/t13-/m1/s1.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate?
[3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate has a molecular weight of 486.41 g/mol, XLogP of 5.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl]methyl 3-[(2R)-2-acetamidopropyl]indole-1-carboxylate is sourced from PubChem (CID 90281040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).