About [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate
[(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate (PubChem CID 90281112) has the molecular formula C13H18N4O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate.
Molecular Properties
| Compound Name | [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate |
| PubChem CID | 90281112 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate |
| SMILES | NC(=O)O[C@H]1CCCN(c2c(N)cnc3c2CCO3)C1 |
| InChI | InChI=1S/C13H18N4O3/c14-10-6-16-12-9(3-5-19-12)11(10)17-4-1-2-8(7-17)20-13(15)18/h6,8H,1-5,7,14H2,(H2,15,18)/t8-/m0/s1 |
| InChIKey | OVIZFTHFBOIGJQ-QMMMGPOBSA-N |
| XLogP | 0.66 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate?
The IUPAC name of [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate (CID 90281112) is [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate.
What is the SMILES notation for [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate?
The canonical SMILES for [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate is NC(=O)O[C@H]1CCCN(c2c(N)cnc3c2CCO3)C1.
What is the InChIKey of [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate?
The InChIKey is OVIZFTHFBOIGJQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H18N4O3/c14-10-6-16-12-9(3-5-19-12)11(10)17-4-1-2-8(7-17)20-13(15)18/h6,8H,1-5,7,14H2,(H2,15,18)/t8-/m0/s1.
What are the key properties of [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate?
[(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate has a molecular weight of 278.31 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-(5-amino-2,3-dihydrofuro[2,3-b]pyridin-4-yl)piperidin-3-yl] carbamate is sourced from PubChem (CID 90281112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).