C36H38F2O6 — CID 90281138
2,2-difluoro-2-[(2R,6R)-2,3,3-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol (PubChem CID 90281138) has the molecular formula C36H38F2O6 and a molecular weight of 604.69 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2R,6R)-2,3,3-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol.
| Compound Name | 2,2-difluoro-2-[(2R,6R)-2,3,3-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol |
|---|---|
| PubChem CID | 90281138 |
| Molecular Formula | C36H38F2O6 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 2,2-difluoro-2-[(2R,6R)-2,3,3-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanol |
| SMILES | OCC(F)(F)[C@]1(OCc2ccccc2)O[C@@H](COCc2ccccc2)CCC1(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C36H38F2O6/c37-34(38,28-39)36(43-26-32-19-11-4-12-20-32)35(41-24-30-15-7-2-8-16-30,42-25-31-17-9-3-10-18-31)22-21-33(44-36)27-40-23-29-13-5-1-6-14-29/h1-20,33,39H,21-28H2/t33-,36+/m1/s1 |
| InChIKey | DXMCWWUMYRNFBR-ILFWFZRHSA-N |
| XLogP | 7.05 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|