C13H18BN3O3 — CID 90281336
5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 90281336) has the molecular formula C13H18BN3O3 and a molecular weight of 275.12 g/mol. Its IUPAC name is 5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 90281336 |
| Molecular Formula | C13H18BN3O3 |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 5-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)ccc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C13H18BN3O3/c1-8-9(6-7-10-15-16-11(18)17(8)10)14-19-12(2,3)13(4,5)20-14/h6-7H,1-5H3,(H,16,18) |
| InChIKey | QXDWIDKRQDIUSC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|