C30H45NO7 — CID 90281621
1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl 4-methylmorpholine-2-carboxylate (PubChem CID 90281621) has the molecular formula C30H45NO7 and a molecular weight of 531.69 g/mol. Its IUPAC name is 1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl 4-methylmorpholine-2-carboxylate.
| Compound Name | 1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl 4-methylmorpholine-2-carboxylate |
|---|---|
| PubChem CID | 90281621 |
| Molecular Formula | C30H45NO7 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 1-[2-hydroxy-5-(2-methoxy-2-oxoethoxy)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-1-yl]octan-3-yl 4-methylmorpholine-2-carboxylate |
| SMILES | CCCCCC(CCC1C(O)CC2Cc3c(cccc3OCC(=O)OC)CC21)OC(=O)C1CN(C)CCO1 |
| InChI | InChI=1S/C30H45NO7/c1-4-5-6-9-22(38-30(34)28-18-31(2)13-14-36-28)11-12-23-24-15-20-8-7-10-27(37-19-29(33)35-3)25(20)16-21(24)17-26(23)32/h7-8,10,21-24,26,28,32H,4-6,9,11-19H2,1-3H3 |
| InChIKey | CISJQLJAEKIABU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|