About 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol
3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol (PubChem CID 90281682) has the molecular formula C19H16F6N2O
and a molecular weight of 402.34 g/mol. Its IUPAC name is 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol.
Molecular Properties
| Compound Name | 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol |
| PubChem CID | 90281682 |
| Molecular Formula | C19H16F6N2O |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol |
| SMILES | OC1CCNCC1n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H16F6N2O/c20-18(21,22)10-1-3-14-12(7-10)13-8-11(19(23,24)25)2-4-15(13)27(14)16-9-26-6-5-17(16)28/h1-4,7-8,16-17,26,28H,5-6,9H2 |
| InChIKey | VLGXCBDZCYEOCB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol?
The IUPAC name of 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol (CID 90281682) is 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol.
What is the SMILES notation for 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol?
The canonical SMILES for 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol is OC1CCNCC1n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21.
What is the InChIKey of 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol?
The InChIKey is VLGXCBDZCYEOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F6N2O/c20-18(21,22)10-1-3-14-12(7-10)13-8-11(19(23,24)25)2-4-15(13)27(14)16-9-26-6-5-17(16)28/h1-4,7-8,16-17,26,28H,5-6,9H2.
What are the key properties of 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol?
3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol has a molecular weight of 402.34 g/mol, XLogP of 4.73, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,6-bis(trifluoromethyl)carbazol-9-yl]piperidin-4-ol is sourced from PubChem (CID 90281682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).