C60H54N15O7P — CID 90281750
tris[[4-(5-methoxy-1-methylindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl] phosphate (PubChem CID 90281750) has the molecular formula C60H54N15O7P and a molecular weight of 1128.16 g/mol. Its IUPAC name is tris[[4-(5-methoxy-1-methylindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl] phosphate.
| Compound Name | tris[[4-(5-methoxy-1-methylindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl] phosphate |
|---|---|
| PubChem CID | 90281750 |
| Molecular Formula | C60H54N15O7P |
| Molecular Weight | 1128.16 g/mol |
| Exact Mass | 1127.41 |
| IUPAC Name | tris[[4-(5-methoxy-1-methylindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl] phosphate |
| SMILES | COc1ccc2c(c1)c(-c1cc3c(ncc4cnc(C)n43)n1COP(=O)(OCn1c(-c3cn(C)c4ccc(OC)cc34)cc3c1ncc1cnc(C)n13)OCn1c(-c3cn(C)c4ccc(OC)cc34)cc3c1ncc1cnc(C)n13)cn2C |
| InChI | InChI=1S/C60H54N15O7P/c1-34-61-22-37-25-64-58-55(73(34)37)19-52(46-28-67(4)49-13-10-40(77-7)16-43(46)49)70(58)31-80-83(76,81-32-71-53(20-56-59(71)65-26-38-23-62-35(2)74(38)56)47-29-68(5)50-14-11-41(78-8)17-44(47)50)82-33-72-54(21-57-60(72)66-27-39-24-63-36(3)75(39)57)48-30-69(6)51-15-12-42(79-9)18-45(48)51/h10-30H,31-33H2,1-9H3 |
| InChIKey | ZVGGVENWJAHWHI-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 192.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.16 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|