About 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine
1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine (PubChem CID 90281838) has the molecular formula C26H37N5S
and a molecular weight of 451.68 g/mol. Its IUPAC name is 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine.
Molecular Properties
| Compound Name | 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine |
| PubChem CID | 90281838 |
| Molecular Formula | C26H37N5S |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine |
| SMILES | CCCCc1cc(N2CCN(C)CC2)cc2c1Nc1ccc(N3CCN(C)CC3)cc1S2 |
| InChI | InChI=1S/C26H37N5S/c1-4-5-6-20-17-22(31-15-11-29(3)12-16-31)19-25-26(20)27-23-8-7-21(18-24(23)32-25)30-13-9-28(2)10-14-30/h7-8,17-19,27H,4-6,9-16H2,1-3H3 |
| InChIKey | IZHSUIXHJZIKDX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine?
The IUPAC name of 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine (CID 90281838) is 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine.
What is the SMILES notation for 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine?
The canonical SMILES for 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine is CCCCc1cc(N2CCN(C)CC2)cc2c1Nc1ccc(N3CCN(C)CC3)cc1S2.
What is the InChIKey of 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine?
The InChIKey is IZHSUIXHJZIKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H37N5S/c1-4-5-6-20-17-22(31-15-11-29(3)12-16-31)19-25-26(20)27-23-8-7-21(18-24(23)32-25)30-13-9-28(2)10-14-30/h7-8,17-19,27H,4-6,9-16H2,1-3H3.
What are the key properties of 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine?
1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine has a molecular weight of 451.68 g/mol, XLogP of 4.74, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,7-bis(4-methylpiperazin-1-yl)-10H-phenothiazine is sourced from PubChem (CID 90281838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).