C24H24F3NO2S — CID 90281853
[2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoropentanoate (PubChem CID 90281853) has the molecular formula C24H24F3NO2S and a molecular weight of 447.52 g/mol. Its IUPAC name is [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoropentanoate.
| Compound Name | [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoropentanoate |
|---|---|
| PubChem CID | 90281853 |
| Molecular Formula | C24H24F3NO2S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [2-methyl-4-(4-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridin-3-yl] 5,5,5-trifluoropentanoate |
| SMILES | Cc1ccc(-c2c(OC(=O)CCCC(F)(F)F)c(C)nc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C24H24F3NO2S/c1-14-9-11-16(12-10-14)20-21-17-6-3-4-7-18(17)31-23(21)28-15(2)22(20)30-19(29)8-5-13-24(25,26)27/h9-12H,3-8,13H2,1-2H3 |
| InChIKey | LLNLYGNEFSUBDS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |