C23H21N3 — CID 90282098
5-quinolin-8-yl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene (PubChem CID 90282098) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 5-quinolin-8-yl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene.
| Compound Name | 5-quinolin-8-yl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 90282098 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 5-quinolin-8-yl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
| SMILES | c1cnc2c(-c3cccc4c5c([nH]c34)C3CCN(CC3)C5)cccc2c1 |
| InChI | InChI=1S/C23H21N3/c1-4-15-5-3-11-24-21(15)17(6-1)18-7-2-8-19-20-14-26-12-9-16(10-13-26)22(20)25-23(18)19/h1-8,11,16,25H,9-10,12-14H2 |
| InChIKey | YQGOEXMFCXVMFX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |