About (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane
(E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane (PubChem CID 90282303) has the molecular formula C5H5Cl2F5
and a molecular weight of 230.99 g/mol. Its IUPAC name is (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane.
Analyze (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane?
The IUPAC name of (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane (CID 90282303) is (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane.
What is the SMILES notation for (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane?
The canonical SMILES for (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane is Cl/C=C/Cl.FC(F)CC(F)(F)F.
What is the InChIKey of (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane?
The InChIKey is XXKHYPGMCWSWHV-WLHGVMLRSA-N. The full InChI is InChI=1S/C3H3F5.C2H2Cl2/c4-2(5)1-3(6,7)8;3-1-2-4/h2H,1H2;1-2H/b;2-1+.
What are the key properties of (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane?
(E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane has a molecular weight of 230.99 g/mol, XLogP of 4.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-dichloroethene;1,1,1,3,3-pentafluoropropane is sourced from PubChem (CID 90282303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).