C22H28F2N6OS — CID 90282364
5-[2,3-difluoro-6-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90282364) has the molecular formula C22H28F2N6OS and a molecular weight of 462.57 g/mol. Its IUPAC name is 5-[2,3-difluoro-6-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2,3-difluoro-6-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90282364 |
| Molecular Formula | C22H28F2N6OS |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 5-[2,3-difluoro-6-methoxy-4-(1H-pyrazol-4-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cc(-c2cn[nH]c2)c(F)c(F)c1-c1nnc(N(C)C2CC(C)(C)NC(C)(C)C2)s1 |
| InChI | InChI=1S/C22H28F2N6OS/c1-21(2)8-13(9-22(3,4)29-21)30(5)20-28-27-19(32-20)16-15(31-6)7-14(17(23)18(16)24)12-10-25-26-11-12/h7,10-11,13,29H,8-9H2,1-6H3,(H,25,26) |
| InChIKey | LKCHRHPPECYRLS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |