C25H33ClN6S — CID 90282470
5-[2-chloro-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90282470) has the molecular formula C25H33ClN6S and a molecular weight of 485.10 g/mol. Its IUPAC name is 5-[2-chloro-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-chloro-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90282470 |
| Molecular Formula | C25H33ClN6S |
| Molecular Weight | 485.10 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 5-[2-chloro-4-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)phenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CN(c1nnc(-c2ccc(-c3cnn4c3CCCC4)cc2Cl)s1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H33ClN6S/c1-24(2)13-17(14-25(3,4)30-24)31(5)23-29-28-22(33-23)18-10-9-16(12-20(18)26)19-15-27-32-11-7-6-8-21(19)32/h9-10,12,15,17,30H,6-8,11,13-14H2,1-5H3 |
| InChIKey | FVTOVLLCKDXLCP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.10 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |