C27H28N7O3+ — CID 90283054
4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(6-methoxy-2-pyridinyl)benzamide (PubChem CID 90283054) has the molecular formula C27H28N7O3+ and a molecular weight of 498.57 g/mol. Its IUPAC name is 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(6-methoxy-2-pyridinyl)benzamide.
| Compound Name | 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(6-methoxy-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 90283054 |
| Molecular Formula | C27H28N7O3+ |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 4-[4-amino-1-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-4-ium-3-yl]-N-(6-methoxy-2-pyridinyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2ccc(C3=NC([C@@H]4CC[C@H]5CCC(=O)N5C4)=C4C=NC=C[N+]34N)cc2)n1 |
| InChI | InChI=1S/C27H27N7O3/c1-37-23-4-2-3-22(30-23)31-27(36)18-7-5-17(6-8-18)26-32-25(21-15-29-13-14-34(21,26)28)19-9-10-20-11-12-24(35)33(20)16-19/h2-8,13-15,19-20H,9-12,16,28H2,1H3/p+1/t19-,20+,34?/m1/s1 |
| InChIKey | ZPXXOHYLNQOKNN-SSGBBQHTSA-O |
| XLogP | 2.96 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|